| Name |
3-[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3,3-dimethylbutanoyl]-3-azabicyclo[4.1.0]heptane-7-carboxylic acid
|
| Molecular Formula |
C28H32N2O5
|
| Molecular Weight |
476.6
|
| Smiles |
CC(C)(C)C(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N1CCC2C(C1)C2C(=O)O
|
CC(C)(C)C(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N1CCC2C(C1)C2C(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.