| Name |
5-(2-chloroacetyl)-hexahydro-2H-1lambda6-[1,2,5]thiadiazolo[2,3-a]piperazine-1,1-dione
|
| Molecular Formula |
C7H12ClN3O3S
|
| Molecular Weight |
253.71
|
| Smiles |
O=C(CCl)N1CCN2C(CNS2(=O)=O)C1
|
O=C(CCl)N1CCN2C(CNS2(=O)=O)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.