| Name |
4,4-difluoro-1-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}cyclohexan-1-amine
|
| Molecular Formula |
C11H13F2N5
|
| Molecular Weight |
253.25
|
| Smiles |
NC1(c2cnc3n[nH]nc3c2)CCC(F)(F)CC1
|
NC1(c2cnc3n[nH]nc3c2)CCC(F)(F)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.