| Name |
rac-(1R,2S,4R,5S)-4,5-dihydroxy-2-(2,2,2-trifluoroacetamido)cyclohexane-1-carboxylic acid
|
| Molecular Formula |
C9H12F3NO5
|
| Molecular Weight |
271.19
|
| Smiles |
O=C(O)C1CC(O)C(O)CC1NC(=O)C(F)(F)F
|
O=C(O)C1CC(O)C(O)CC1NC(=O)C(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.