| Name |
2-{[(Tert-butoxy)carbonyl]amino}-5-(2,2-dimethylpropyl)-1,3-thiazole-4-carboxylic acid
|
| Molecular Formula |
C14H22N2O4S
|
| Molecular Weight |
314.40
|
| Smiles |
CC(C)(C)Cc1sc(NC(=O)OC(C)(C)C)nc1C(=O)O
|
CC(C)(C)Cc1sc(NC(=O)OC(C)(C)C)nc1C(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.