| Name |
Olean-12-en-28-oic acid, 2,3,19,23-tetrahydroxy-, methyl ester, (2I+/-,3I(2),4I+/-,19I+/-)-
|
| Molecular Formula |
C31H50O6
|
| Molecular Weight |
518.7
|
| Smiles |
COC(=O)C12CCC(C)(C)C(O)C1C1=CCC3C4(C)CC(O)C(O)C(C)(CO)C4CCC3(C)C1(C)CC2
|
COC(=O)C12CCC(C)(C)C(O)C1C1=CCC3C4(C)CC(O)C(O)C(C)(CO)C4CCC3(C)C1(C)CC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.