| Name |
4-{[3-(2-methoxyethyl)-4H-1,2,4-triazol-4-yl]methyl}benzoic acid
|
| Molecular Formula |
C13H15N3O3
|
| Molecular Weight |
261.28
|
| Smiles |
COCCc1nncn1Cc1ccc(C(=O)O)cc1
|
COCCc1nncn1Cc1ccc(C(=O)O)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.