| Name |
(1R)-1-{4-chloro-7H-pyrrolo[2,3-d]pyrimidin-5-yl}ethan-1-amine
|
| Molecular Formula |
C8H9ClN4
|
| Molecular Weight |
196.64
|
| Smiles |
CC(N)c1c[nH]c2ncnc(Cl)c12
|
CC(N)c1c[nH]c2ncnc(Cl)c12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.