| Name |
3-(9-chloro-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3,3-difluoropropan-1-ol
|
| Molecular Formula |
C12H13ClF2O3
|
| Molecular Weight |
278.68
|
| Smiles |
OCCC(F)(F)c1cc(Cl)c2c(c1)OCCCO2
|
OCCC(F)(F)c1cc(Cl)c2c(c1)OCCCO2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.