| Name |
N-(1-{[1,2,4]triazolo[4,3-b]pyridazin-6-yl}piperidin-4-yl)cyclobutanecarboxamide
|
| Molecular Formula |
C15H20N6O
|
| Molecular Weight |
300.36
|
| Smiles |
O=C(NC1CCN(c2ccc3nncn3n2)CC1)C1CCC1
|
O=C(NC1CCN(c2ccc3nncn3n2)CC1)C1CCC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.