| Name |
4-Acetyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxylic acid
|
| Molecular Formula |
C9H10F3NO4
|
| Molecular Weight |
253.17
|
| Smiles |
CC(=O)C1CC(C(=O)O)N(C(=O)C(F)(F)F)C1
|
CC(=O)C1CC(C(=O)O)N(C(=O)C(F)(F)F)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.