| Name |
3-{2,2-Difluoro-1-[(2,2,2-trifluoroacetamido)methyl]cyclopropyl}propanoic acid
|
| Molecular Formula |
C9H10F5NO3
|
| Molecular Weight |
275.17
|
| Smiles |
O=C(O)CCC1(CNC(=O)C(F)(F)F)CC1(F)F
|
O=C(O)CCC1(CNC(=O)C(F)(F)F)CC1(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.