| Name |
rac-2-[(1R,2R,4S)-2-hydroxy-4-{[(prop-2-en-1-yloxy)carbonyl]amino}cyclobutyl]acetic acid
|
| Molecular Formula |
C10H15NO5
|
| Molecular Weight |
229.23
|
| Smiles |
C=CCOC(=O)NC1CC(O)C1CC(=O)O
|
C=CCOC(=O)NC1CC(O)C1CC(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.