| Name |
Lithium(1+) 2-(3-cyanophenyl)-2,2-difluoroacetate
|
| Molecular Formula |
C9H4F2LiNO2
|
| Molecular Weight |
203.1
|
| Smiles |
N#Cc1cccc(C(F)(F)C(=O)[O-])c1.[Li+]
|
N#Cc1cccc(C(F)(F)C(=O)[O-])c1.[Li+]
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.