| Name |
ethyl 5-(5-ethyl-1,3-thiazol-2-yl)-1H-1,2,3-triazole-4-carboxylate
|
| Molecular Formula |
C10H12N4O2S
|
| Molecular Weight |
252.30
|
| Smiles |
CCOC(=O)c1n[nH]nc1-c1ncc(CC)s1
|
CCOC(=O)c1n[nH]nc1-c1ncc(CC)s1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.