| Name |
2-{[1-(2-bromo-6-fluorophenyl)-1H-1,2,3-triazol-4-yl]methoxy}ethan-1-ol
|
| Molecular Formula |
C11H11BrFN3O2
|
| Molecular Weight |
316.13
|
| Smiles |
OCCOCc1cn(-c2c(F)cccc2Br)nn1
|
OCCOCc1cn(-c2c(F)cccc2Br)nn1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.