| Name |
4-(2,2-dimethylcyclopropyl)-4-methyl-3H,4H,5H,6H,7H-imidazo[4,5-c]pyridine
|
| Molecular Formula |
C12H19N3
|
| Molecular Weight |
205.30
|
| Smiles |
CC1(C)CC1C1(C)NCCc2[nH]cnc21
|
CC1(C)CC1C1(C)NCCc2[nH]cnc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.