| Name |
Ammonium perfluoro-2-{[1-(1,2-dichloro-1,2,2-trifluoroethoxy)propan-2-yl]oxy}ethane-1-sulfonate
|
| Molecular Formula |
C7H4Cl2F13NO5S
|
| Molecular Weight |
532.06
|
| Smiles |
O=S(=O)([O-])C(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)(Cl)C(F)(F)Cl.[NH4+]
|
O=S(=O)([O-])C(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)(Cl)C(F)(F)Cl.[NH4+]
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.