| Name |
5-Chloro-2-(3-{[1,2,4]triazolo[4,3-a]pyridin-3-yl}azetidin-1-yl)-1,3-benzoxazole
|
| Molecular Formula |
C16H12ClN5O
|
| Molecular Weight |
325.75
|
| Smiles |
Clc1ccc2oc(N3CC(c4nnc5ccccn45)C3)nc2c1
|
Clc1ccc2oc(N3CC(c4nnc5ccccn45)C3)nc2c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.