| Name |
3-(1-{1-[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)ethyl]-1H-1,2,3-triazol-4-yl}-N-methylformamido)propanoic acid
|
| Molecular Formula |
C24H25N5O5
|
| Molecular Weight |
463.5
|
| Smiles |
CN(CCC(=O)O)C(=O)c1cn(CCNC(=O)OCC2c3ccccc3-c3ccccc32)nn1
|
CN(CCC(=O)O)C(=O)c1cn(CCNC(=O)OCC2c3ccccc3-c3ccccc32)nn1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.