| Name |
1,1,2,2-Tetrakis(3'-([2,2':6',2''-terpyridin]-4'-yl)-[1,1'-biphenyl]-4-yl)ethene
|
| Molecular Formula |
C110H72N12
|
| Molecular Weight |
1561.8
|
| Smiles |
c1ccc(-c2cc(-c3cccc(-c4ccc(C(=C(c5ccc(-c6cccc(-c7cc(-c8ccccn8)nc(-c8ccccn8)c7)c6)cc5)c5ccc(-c6cccc(-c7cc(-c8ccccn8)nc(-c8ccccn8)c7)c6)cc5)c5ccc(-c6cccc(-c7cc(-c8ccccn8)nc(-c8ccccn8)c7)c6)cc5)cc4)c3)cc(-c3ccccn3)n2)nc1
|
c1ccc(-c2cc(-c3cccc(-c4ccc(C(=C(c5ccc(-c6cccc(-c7cc(-c8ccccn8)nc(-c8ccccn8)c7)c6)cc5)c5ccc(-c6cccc(-c7cc(-c8ccccn8)nc(-c8ccccn8)c7)c6)cc5)c5ccc(-c6cccc(-c7cc(-c8ccccn8)nc(-c8ccccn8)c7)c6)cc5)cc4)c3)cc(-c3ccccn3)n2)nc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.