| Name |
(S)-10-Amino-1H,3H,5H-spiro[benzo[d]pyrazolo[1,2-a][1,2]diazepine-2,1'-cyclopropane]-5,11(10H)-dione hydrochloride
|
| Molecular Formula |
C14H16ClN3O2
|
| Molecular Weight |
293.75
|
| Smiles |
Cl.NC1C(=O)N2CC3(CC3)CN2C(=O)c2ccccc21
|
Cl.NC1C(=O)N2CC3(CC3)CN2C(=O)c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.