| Name |
Pregna-1,4-diene-3,20-dione, 2-chloro-9-fluoro-11,17,21-trihydroxy-16-methyl-, (11I(2),16I+/-)-
|
| Molecular Formula |
C22H28ClFO5
|
| Molecular Weight |
426.9
|
| Smiles |
CC1CC2C3CCC4=CC(=O)C(Cl)=CC4(C)C3(F)C(O)CC2(C)C1(O)C(=O)CO
|
CC1CC2C3CCC4=CC(=O)C(Cl)=CC4(C)C3(F)C(O)CC2(C)C1(O)C(=O)CO
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.