| Name |
(1RS,3SR)-3-[(2R,3S)-3-(benzyloxy)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanamido]cyclopentane-1-carboxylic acid
|
| Molecular Formula |
C32H34N2O6
|
| Molecular Weight |
542.6
|
| Smiles |
CC(OCc1ccccc1)C(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NC1CCC(C(=O)O)C1
|
CC(OCc1ccccc1)C(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NC1CCC(C(=O)O)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.