| Name |
(2R)-2-{[4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]formamido}-3-hydroxypropanoic acid
|
| Molecular Formula |
C25H22N2O6
|
| Molecular Weight |
446.5
|
| Smiles |
O=C(Nc1ccc(C(=O)NC(CO)C(=O)O)cc1)OCC1c2ccccc2-c2ccccc21
|
O=C(Nc1ccc(C(=O)NC(CO)C(=O)O)cc1)OCC1c2ccccc2-c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.