| Name |
5-(2-tert-butyl-2H-1,2,3,4-tetrazol-5-yl)-1,2-oxazol-4-amine
|
| Molecular Formula |
C8H12N6O
|
| Molecular Weight |
208.22
|
| Smiles |
CC(C)(C)n1nnc(-c2oncc2N)n1
|
CC(C)(C)n1nnc(-c2oncc2N)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.