| Name |
2-{4H,5H,6H,7H-pyrazolo[1,5-a]pyrazin-3-yl}-5-(trifluoromethyl)pyridine
|
| Molecular Formula |
C12H11F3N4
|
| Molecular Weight |
268.24
|
| Smiles |
FC(F)(F)c1ccc(-c2cnn3c2CNCC3)nc1
|
FC(F)(F)c1ccc(-c2cnn3c2CNCC3)nc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.