| Name |
(1R)-1-[(2S,4aR,4bR,8aR)-2,4b,8,8-tetramethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-2-yl]ethane-1,2-diol
|
| Molecular Formula |
C20H34O2
|
| Molecular Weight |
306.5
|
| Smiles |
CC1(C)CCCC2(C)C3CCC(C)(C(O)CO)C=C3CCC12
|
CC1(C)CCCC2(C)C3CCC(C)(C(O)CO)C=C3CCC12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.