| Name |
2-(1-{3-[({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)methyl]-1,2-oxazole-4-carbonyl}azetidin-3-yl)acetic acid
|
| Molecular Formula |
C25H23N3O6
|
| Molecular Weight |
461.5
|
| Smiles |
O=C(O)CC1CN(C(=O)c2conc2CNC(=O)OCC2c3ccccc3-c3ccccc32)C1
|
O=C(O)CC1CN(C(=O)c2conc2CNC(=O)OCC2c3ccccc3-c3ccccc32)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.