| Name |
(I+/-R)-2,5-Dichloro-I+/--(3,3-dimethylbutyl)benzenemethanamine
|
| Molecular Formula |
C13H19Cl2N
|
| Molecular Weight |
260.20
|
| Smiles |
CC(C)(C)CCC(N)c1cc(Cl)ccc1Cl
|
CC(C)(C)CCC(N)c1cc(Cl)ccc1Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.