| Name |
3-(4-{[(Tert-butoxy)carbonyl]amino}-3-chlorophenyl)-4,4-difluorobutanoic acid
|
| Molecular Formula |
C15H18ClF2NO4
|
| Molecular Weight |
349.76
|
| Smiles |
CC(C)(C)OC(=O)Nc1ccc(C(CC(=O)O)C(F)F)cc1Cl
|
CC(C)(C)OC(=O)Nc1ccc(C(CC(=O)O)C(F)F)cc1Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.