| Name |
5-[2-(Propan-2-yl)-1,3-thiazol-5-yl]-1,3-oxazolidin-2-one
|
| Molecular Formula |
C9H12N2O2S
|
| Molecular Weight |
212.27
|
| Smiles |
CC(C)c1ncc(C2CNC(=O)O2)s1
|
CC(C)c1ncc(C2CNC(=O)O2)s1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.