| Name |
3-(3-bromophenyl)-2H,4H,6H,7H-thiopyrano[4,3-c]pyrazole
|
| Molecular Formula |
C12H11BrN2S
|
| Molecular Weight |
295.20
|
| Smiles |
Brc1cccc(-c2n[nH]c3c2CSCC3)c1
|
Brc1cccc(-c2n[nH]c3c2CSCC3)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.