| Name |
8-chloro-2-oxo-3,4-dihydro-2H-1,3-benzoxazine-6-carboxylic acid
|
| Molecular Formula |
C9H6ClNO4
|
| Molecular Weight |
227.60
|
| Smiles |
O=C1NCc2cc(C(=O)O)cc(Cl)c2O1
|
O=C1NCc2cc(C(=O)O)cc(Cl)c2O1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.