| Name |
1-[(2S)-4-(benzyloxy)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-4-oxobutanoyl]-1,2,3,6-tetrahydropyridine-4-carboxylic acid
|
| Molecular Formula |
C32H30N2O7
|
| Molecular Weight |
554.6
|
| Smiles |
O=C(CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N1CC=C(C(=O)O)CC1)OCc1ccccc1
|
O=C(CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N1CC=C(C(=O)O)CC1)OCc1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.