| Name |
1-[6-(2-Fluorophenyl)imidazo[2,1-b]thiazol-5-yl]-1,2-ethanediamine
|
| Molecular Formula |
C13H13FN4S
|
| Molecular Weight |
276.33
|
| Smiles |
NCC(N)c1c(-c2ccccc2F)nc2sccn12
|
NCC(N)c1c(-c2ccccc2F)nc2sccn12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.