| Name |
5-chloro-4,6-difluoro-2,3-dihydro-1H-indole-2,3-dione
|
| Molecular Formula |
C8H2ClF2NO2
|
| Molecular Weight |
217.55
|
| Smiles |
O=C1Nc2cc(F)c(Cl)c(F)c2C1=O
|
O=C1Nc2cc(F)c(Cl)c(F)c2C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.