| Name |
2-{4-[(5,6-diphenylpyrazin-2-yl)thio]butyloxy}acetic Acid Tert-Butyl Ester
|
| Molecular Formula |
C26H30N2O3S
|
| Molecular Weight |
450.6
|
| Smiles |
CC(C)(C)OC(=O)COCCCCSc1cnc(-c2ccccc2)c(-c2ccccc2)n1
|
CC(C)(C)OC(=O)COCCCCSc1cnc(-c2ccccc2)c(-c2ccccc2)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.