| Name |
2-(4-amino-1H-pyrrolo[3,2-c]pyridin-1-yl)-N,N-dimethylacetamide
|
| Molecular Formula |
C11H14N4O
|
| Molecular Weight |
218.26
|
| Smiles |
CN(C)C(=O)Cn1ccc2c(N)nccc21
|
CN(C)C(=O)Cn1ccc2c(N)nccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.