| Name |
1,2,3-Propanetricarboxamide, N1,N2,N3-tris(2-methylcyclohexyl)-
|
| Molecular Formula |
C27H47N3O3
|
| Molecular Weight |
461.7
|
| Smiles |
CC1CCCCC1NC(=O)CC(CC(=O)NC1CCCCC1C)C(=O)NC1CCCCC1C
|
CC1CCCCC1NC(=O)CC(CC(=O)NC1CCCCC1C)C(=O)NC1CCCCC1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.