| Name |
4'-(Bromomethyl)-2,6-dichloro-3'-(trifluoromethyl)-1,1'-biphenyl
|
| Molecular Formula |
C14H8BrCl2F3
|
| Molecular Weight |
384.0
|
| Smiles |
FC(F)(F)c1cc(-c2c(Cl)cccc2Cl)ccc1CBr
|
FC(F)(F)c1cc(-c2c(Cl)cccc2Cl)ccc1CBr
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.