| Name |
2',6'-Dichloro-1,2,3,6-tetrahydro-4,4'-bipyridine
|
| Molecular Formula |
C10H10Cl2N2
|
| Molecular Weight |
229.10
|
| Smiles |
Clc1cc(C2=CCNCC2)cc(Cl)n1
|
Clc1cc(C2=CCNCC2)cc(Cl)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.