| Name |
7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-ethyl-4H-pyrido[4,3-d]pyrimidin-2-one
|
| Molecular Formula |
C17H16Cl3N3O3
|
| Molecular Weight |
416.7
|
| Smiles |
CCN1C(=O)N(c2c(Cl)c(OC)cc(OC)c2Cl)Cc2cnc(Cl)cc21
|
CCN1C(=O)N(c2c(Cl)c(OC)cc(OC)c2Cl)Cc2cnc(Cl)cc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.