| Name |
4-Chloro-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2(3H)-one
|
| Molecular Formula |
C7H8ClN3O
|
| Molecular Weight |
185.61
|
| Smiles |
O=c1nc(Cl)c2c([nH]1)CNCC2
|
O=c1nc(Cl)c2c([nH]1)CNCC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.