| Name |
N-(cyclopropylmethyl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine
|
| Molecular Formula |
C11H16N4
|
| Molecular Weight |
204.27
|
| Smiles |
c1nc2c(c(NCC3CC3)n1)CCNC2
|
c1nc2c(c(NCC3CC3)n1)CCNC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.