| Name |
tert-Butyl octahydrocyclobuta[1,2-c:3,4-c']dipyrrole-2(3bH)-carboxylate
|
| Molecular Formula |
C13H22N2O2
|
| Molecular Weight |
238.33
|
| Smiles |
CC(C)(C)OC(=O)N1CC2C3CNCC3C2C1
|
CC(C)(C)OC(=O)N1CC2C3CNCC3C2C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.