| Name |
7-bromo-4-chloro-3,3,5-trimethyl-2,3-dihydro-1H-indole
|
| Molecular Formula |
C11H13BrClN
|
| Molecular Weight |
274.58
|
| Smiles |
Cc1cc(Br)c2c(c1Cl)C(C)(C)CN2
|
Cc1cc(Br)c2c(c1Cl)C(C)(C)CN2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.