| Name |
Adenosine 5a(2)-(trihydrogen diphosphate), Pa(2)a5a(2)-ester with 1,6-dihydro-6-imino-1-I(2)-D-ribofuranosyl-3-pyridinecarboxamide
|
| Molecular Formula |
C21H28N8O14P2
|
| Molecular Weight |
678.4
|
| Smiles |
N=c1ccc(C(N)=O)cn1C1OC(COP(=O)(O)OP(=O)(O)OCC2OC(n3cnc4c(N)ncnc43)C(O)C2O)C(O)C1O
|
N=c1ccc(C(N)=O)cn1C1OC(COP(=O)(O)OP(=O)(O)OCC2OC(n3cnc4c(N)ncnc43)C(O)C2O)C(O)C1O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.