| Name |
2,3,5-Tribromo-4-(2,4-dibromophenoxy)phenol
|
| Molecular Formula |
C12H5Br5O2
|
| Molecular Weight |
580.7
|
| Smiles |
Oc1cc(Br)c(Oc2ccc(Br)cc2Br)c(Br)c1Br
|
Oc1cc(Br)c(Oc2ccc(Br)cc2Br)c(Br)c1Br
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.