| Name |
N-{2-methyl-2H,4H,5H,6H,7H-pyrazolo[4,3-c]pyridin-3-yl}-4-nitrobenzene-1-sulfonamide
|
| Molecular Formula |
C13H15N5O4S
|
| Molecular Weight |
337.36
|
| Smiles |
Cn1nc2c(c1NS(=O)(=O)c1ccc([N+](=O)[O-])cc1)CNCC2
|
Cn1nc2c(c1NS(=O)(=O)c1ccc([N+](=O)[O-])cc1)CNCC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.